About 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene
2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene (PubChem CID 11159420) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene.
Molecular Properties
| Compound Name | 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene |
| PubChem CID | 11159420 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene |
| SMILES | C=CCOC(C(=C)C)C(=C)C |
| InChI | InChI=1S/C10H16O/c1-6-7-11-10(8(2)3)9(4)5/h6,10H,1-2,4,7H2,3,5H3 |
| InChIKey | ADWPUZCAYBVLAT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene?
The IUPAC name of 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene (CID 11159420) is 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene.
What is the SMILES notation for 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene?
The canonical SMILES for 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene is C=CCOC(C(=C)C)C(=C)C.
What is the InChIKey of 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene?
The InChIKey is ADWPUZCAYBVLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-6-7-11-10(8(2)3)9(4)5/h6,10H,1-2,4,7H2,3,5H3.
What are the key properties of 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene?
2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene has a molecular weight of 152.24 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3-prop-2-enoxypenta-1,4-diene is sourced from PubChem (CID 11159420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).