(2S)-2,6-diamino-2-methylhexanoic acid

C7H16N2O2 — CID 11159478

IUPAC(2S)-2,6-diamino-2-methylhexanoic acid
SMILESC[C@](N)(CCCCN)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-7(9,6(10)11)4-2-3-5-8/h2-5,8-9H2,1H3,(H,10,11)/t7-/m0/s1
InChIKeyCPUSCHYXEUZMSV-ZETCQYMHSA-N
MW160.22 g/mol
LogP-0.08
Rot. Bonds5

About (2S)-2,6-diamino-2-methylhexanoic acid

(2S)-2,6-diamino-2-methylhexanoic acid (PubChem CID 11159478) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (2S)-2,6-diamino-2-methylhexanoic acid.

Molecular Properties

Compound Name(2S)-2,6-diamino-2-methylhexanoic acid
PubChem CID11159478
Molecular FormulaC7H16N2O2
Molecular Weight160.22 g/mol
Exact Mass160.12
IUPAC Name(2S)-2,6-diamino-2-methylhexanoic acid
SMILESC[C@](N)(CCCCN)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-7(9,6(10)11)4-2-3-5-8/h2-5,8-9H2,1H3,(H,10,11)/t7-/m0/s1
InChIKeyCPUSCHYXEUZMSV-ZETCQYMHSA-N
XLogP-0.08
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.22
LogP ≤ 5-0.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S)-2,6-diamino-2-methylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,6-diamino-2-methylhexanoic acid?
The IUPAC name of (2S)-2,6-diamino-2-methylhexanoic acid (CID 11159478) is (2S)-2,6-diamino-2-methylhexanoic acid.
What is the SMILES notation for (2S)-2,6-diamino-2-methylhexanoic acid?
The canonical SMILES for (2S)-2,6-diamino-2-methylhexanoic acid is C[C@](N)(CCCCN)C(=O)O.
What is the InChIKey of (2S)-2,6-diamino-2-methylhexanoic acid?
The InChIKey is CPUSCHYXEUZMSV-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-7(9,6(10)11)4-2-3-5-8/h2-5,8-9H2,1H3,(H,10,11)/t7-/m0/s1.
What are the key properties of (2S)-2,6-diamino-2-methylhexanoic acid?
(2S)-2,6-diamino-2-methylhexanoic acid has a molecular weight of 160.22 g/mol, XLogP of -0.08, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diamino-2-methylhexanoic acid is sourced from PubChem (CID 11159478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).