C20H28IN7O — CID 111595016
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111595016) has the molecular formula C20H28IN7O and a molecular weight of 509.40 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111595016 |
| Molecular Formula | C20H28IN7O |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C20H27N7O.HI/c1-5-22-19(25-12-18-23-11-17(28-18)20(2,3)4)24-10-15-6-8-16(9-7-15)27-14-21-13-26-27;/h6-9,11,13-14H,5,10,12H2,1-4H3,(H2,22,24,25);1H |
| InChIKey | HJDNTNBQUCFBKA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|