C22H32IN5O2 — CID 111595383
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111595383) has the molecular formula C22H32IN5O2 and a molecular weight of 525.44 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111595383 |
| Molecular Formula | C22H32IN5O2 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCCc2ccccc21)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C22H31N5O2.HI/c1-5-23-21(25-14-19-24-13-18(29-19)22(2,3)4)26-15-20(28)27-12-8-10-16-9-6-7-11-17(16)27;/h6-7,9,11,13H,5,8,10,12,14-15H2,1-4H3,(H2,23,25,26);1H |
| InChIKey | LKUSHPQPFOVEKR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|