About 4-cyano-N,N-diethylbutanamide
4-cyano-N,N-diethylbutanamide (PubChem CID 11159555) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-cyano-N,N-diethylbutanamide.
Molecular Properties
| Compound Name | 4-cyano-N,N-diethylbutanamide |
| PubChem CID | 11159555 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4-cyano-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCC#N |
| InChI | InChI=1S/C9H16N2O/c1-3-11(4-2)9(12)7-5-6-8-10/h3-7H2,1-2H3 |
| InChIKey | VOCMRXOIEFQAII-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-N,N-diethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N,N-diethylbutanamide?
The IUPAC name of 4-cyano-N,N-diethylbutanamide (CID 11159555) is 4-cyano-N,N-diethylbutanamide.
What is the SMILES notation for 4-cyano-N,N-diethylbutanamide?
The canonical SMILES for 4-cyano-N,N-diethylbutanamide is CCN(CC)C(=O)CCCC#N.
What is the InChIKey of 4-cyano-N,N-diethylbutanamide?
The InChIKey is VOCMRXOIEFQAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-3-11(4-2)9(12)7-5-6-8-10/h3-7H2,1-2H3.
What are the key properties of 4-cyano-N,N-diethylbutanamide?
4-cyano-N,N-diethylbutanamide has a molecular weight of 168.24 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N,N-diethylbutanamide is sourced from PubChem (CID 11159555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).