About 2-methoxy-N,N-dimethylbenzamide
2-methoxy-N,N-dimethylbenzamide (PubChem CID 11159646) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-methoxy-N,N-dimethylbenzamide |
| PubChem CID | 11159646 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-methoxy-N,N-dimethylbenzamide |
| SMILES | COc1ccccc1C(=O)N(C)C |
| InChI | InChI=1S/C10H13NO2/c1-11(2)10(12)8-6-4-5-7-9(8)13-3/h4-7H,1-3H3 |
| InChIKey | ZBWYZLANPMFDMN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,N-dimethylbenzamide?
The IUPAC name of 2-methoxy-N,N-dimethylbenzamide (CID 11159646) is 2-methoxy-N,N-dimethylbenzamide.
What is the SMILES notation for 2-methoxy-N,N-dimethylbenzamide?
The canonical SMILES for 2-methoxy-N,N-dimethylbenzamide is COc1ccccc1C(=O)N(C)C.
What is the InChIKey of 2-methoxy-N,N-dimethylbenzamide?
The InChIKey is ZBWYZLANPMFDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-11(2)10(12)8-6-4-5-7-9(8)13-3/h4-7H,1-3H3.
What are the key properties of 2-methoxy-N,N-dimethylbenzamide?
2-methoxy-N,N-dimethylbenzamide has a molecular weight of 179.22 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,N-dimethylbenzamide is sourced from PubChem (CID 11159646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).