About 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide
2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide (PubChem CID 111596514) has the molecular formula C17H22N4O2
and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide.
Molecular Properties
| Compound Name | 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide |
| PubChem CID | 111596514 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide |
| SMILES | CCN(CC(C)(C)O)C(=O)C(C#N)=Cc1cc(C#N)n(C)c1C |
| InChI | InChI=1S/C17H22N4O2/c1-6-21(11-17(3,4)23)16(22)14(9-18)7-13-8-15(10-19)20(5)12(13)2/h7-8,23H,6,11H2,1-5H3 |
| InChIKey | RDWVTJLNNFMEGM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide?
The IUPAC name of 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide (CID 111596514) is 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide.
What is the SMILES notation for 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide?
The canonical SMILES for 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide is CCN(CC(C)(C)O)C(=O)C(C#N)=Cc1cc(C#N)n(C)c1C.
What is the InChIKey of 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide?
The InChIKey is RDWVTJLNNFMEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2/c1-6-21(11-17(3,4)23)16(22)14(9-18)7-13-8-15(10-19)20(5)12(13)2/h7-8,23H,6,11H2,1-5H3.
What are the key properties of 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide?
2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide has a molecular weight of 314.39 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-(5-cyano-1,2-dimethylpyrrol-3-yl)-N-ethyl-N-(2-hydroxy-2-methylpropyl)prop-2-enamide is sourced from PubChem (CID 111596514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).