methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate

C9H12O4 — CID 11159704

IUPACmethyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate
SMILESC#C[C@@H]1OC(C)(C)O[C@H]1C(=O)OC
InChIInChI=1S/C9H12O4/c1-5-6-7(8(10)11-4)13-9(2,3)12-6/h1,6-7H,2-4H3/t6-,7+/m0/s1
InChIKeyLGCOAZFVZUCYOT-NKWVEPMBSA-N
MW184.19 g/mol
LogP0.31
Rot. Bonds1

About methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate

methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 11159704) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate.

Molecular Properties

Compound Namemethyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate
PubChem CID11159704
Molecular FormulaC9H12O4
Molecular Weight184.19 g/mol
Exact Mass184.07
IUPAC Namemethyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate
SMILESC#C[C@@H]1OC(C)(C)O[C@H]1C(=O)OC
InChIInChI=1S/C9H12O4/c1-5-6-7(8(10)11-4)13-9(2,3)12-6/h1,6-7H,2-4H3/t6-,7+/m0/s1
InChIKeyLGCOAZFVZUCYOT-NKWVEPMBSA-N
XLogP0.31
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 50.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The IUPAC name of methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate (CID 11159704) is methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
What is the SMILES notation for methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The canonical SMILES for methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate is C#C[C@@H]1OC(C)(C)O[C@H]1C(=O)OC.
What is the InChIKey of methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The InChIKey is LGCOAZFVZUCYOT-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H12O4/c1-5-6-7(8(10)11-4)13-9(2,3)12-6/h1,6-7H,2-4H3/t6-,7+/m0/s1.
What are the key properties of methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate has a molecular weight of 184.19 g/mol, XLogP of 0.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4R,5S)-5-ethynyl-2,2-dimethyl-1,3-dioxolane-4-carboxylate is sourced from PubChem (CID 11159704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).