C14H18BrNO2S — CID 111597105
3-(3-bromophenyl)-N-[(3-hydroxythiolan-3-yl)methyl]propanamide (PubChem CID 111597105) has the molecular formula C14H18BrNO2S and a molecular weight of 344.27 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-[(3-hydroxythiolan-3-yl)methyl]propanamide.
| Compound Name | 3-(3-bromophenyl)-N-[(3-hydroxythiolan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 111597105 |
| Molecular Formula | C14H18BrNO2S |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 3-(3-bromophenyl)-N-[(3-hydroxythiolan-3-yl)methyl]propanamide |
| SMILES | O=C(CCc1cccc(Br)c1)NCC1(O)CCSC1 |
| InChI | InChI=1S/C14H18BrNO2S/c15-12-3-1-2-11(8-12)4-5-13(17)16-9-14(18)6-7-19-10-14/h1-3,8,18H,4-7,9-10H2,(H,16,17) |
| InChIKey | AOFZSVHWJCMYKF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |