C9H18N2O2S — CID 111597399
1-[(3-hydroxythiolan-3-yl)methyl]-3-propan-2-ylurea (PubChem CID 111597399) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-[(3-hydroxythiolan-3-yl)methyl]-3-propan-2-ylurea.
| Compound Name | 1-[(3-hydroxythiolan-3-yl)methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 111597399 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[(3-hydroxythiolan-3-yl)methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCC1(O)CCSC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-7(2)11-8(12)10-5-9(13)3-4-14-6-9/h7,13H,3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | LQGZXHMHSOBVJX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |