C10H10N2O2 — CID 11159799
3-(imidazol-1-ylmethyl)benzene-1,2-diol (PubChem CID 11159799) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)benzene-1,2-diol.
| Compound Name | 3-(imidazol-1-ylmethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 11159799 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)benzene-1,2-diol |
| SMILES | Oc1cccc(Cn2ccnc2)c1O |
| InChI | InChI=1S/C10H10N2O2/c13-9-3-1-2-8(10(9)14)6-12-5-4-11-7-12/h1-5,7,13-14H,6H2 |
| InChIKey | FQBZLMXHTJDUIV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|