About thieno[3,4-b][1,4]benzodioxine
thieno[3,4-b][1,4]benzodioxine (PubChem CID 11159801) has the molecular formula C10H6O2S
and a molecular weight of 190.22 g/mol. Its IUPAC name is thieno[3,4-b][1,4]benzodioxine.
Molecular Properties
| Compound Name | thieno[3,4-b][1,4]benzodioxine |
| PubChem CID | 11159801 |
| Molecular Formula | C10H6O2S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | thieno[3,4-b][1,4]benzodioxine |
| SMILES | c1ccc2c(c1)Oc1cscc1O2 |
| InChI | InChI=1S/C10H6O2S/c1-2-4-8-7(3-1)11-9-5-13-6-10(9)12-8/h1-6H |
| InChIKey | LMGSINXRBULTRV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[3,4-b][1,4]benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,4-b][1,4]benzodioxine?
The IUPAC name of thieno[3,4-b][1,4]benzodioxine (CID 11159801) is thieno[3,4-b][1,4]benzodioxine.
What is the SMILES notation for thieno[3,4-b][1,4]benzodioxine?
The canonical SMILES for thieno[3,4-b][1,4]benzodioxine is c1ccc2c(c1)Oc1cscc1O2.
What is the InChIKey of thieno[3,4-b][1,4]benzodioxine?
The InChIKey is LMGSINXRBULTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2S/c1-2-4-8-7(3-1)11-9-5-13-6-10(9)12-8/h1-6H.
What are the key properties of thieno[3,4-b][1,4]benzodioxine?
thieno[3,4-b][1,4]benzodioxine has a molecular weight of 190.22 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,4-b][1,4]benzodioxine is sourced from PubChem (CID 11159801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).