About N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine
N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine (PubChem CID 11159892) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine.
Molecular Properties
| Compound Name | N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine |
| PubChem CID | 11159892 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine |
| SMILES | CCN(CC)C1=NC(OC)=NC=CC1 |
| InChI | InChI=1S/C10H17N3O/c1-4-13(5-2)9-7-6-8-11-10(12-9)14-3/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | CFCLORKPHUZYKN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine?
The IUPAC name of N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine (CID 11159892) is N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine.
What is the SMILES notation for N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine?
The canonical SMILES for N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine is CCN(CC)C1=NC(OC)=NC=CC1.
What is the InChIKey of N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine?
The InChIKey is CFCLORKPHUZYKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-4-13(5-2)9-7-6-8-11-10(12-9)14-3/h6,8H,4-5,7H2,1-3H3.
What are the key properties of N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine?
N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine has a molecular weight of 195.27 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-methoxy-5H-1,3-diazepin-4-amine is sourced from PubChem (CID 11159892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).