About 4-methyl-5H-indeno[1,2-b]pyridin-5-ol
4-methyl-5H-indeno[1,2-b]pyridin-5-ol (PubChem CID 11159919) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-methyl-5H-indeno[1,2-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 4-methyl-5H-indeno[1,2-b]pyridin-5-ol |
| PubChem CID | 11159919 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-methyl-5H-indeno[1,2-b]pyridin-5-ol |
| SMILES | Cc1ccnc2c1C(O)c1ccccc1-2 |
| InChI | InChI=1S/C13H11NO/c1-8-6-7-14-12-9-4-2-3-5-10(9)13(15)11(8)12/h2-7,13,15H,1H3 |
| InChIKey | QPDHHOPKWKFAIY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-5H-indeno[1,2-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5H-indeno[1,2-b]pyridin-5-ol?
The IUPAC name of 4-methyl-5H-indeno[1,2-b]pyridin-5-ol (CID 11159919) is 4-methyl-5H-indeno[1,2-b]pyridin-5-ol.
What is the SMILES notation for 4-methyl-5H-indeno[1,2-b]pyridin-5-ol?
The canonical SMILES for 4-methyl-5H-indeno[1,2-b]pyridin-5-ol is Cc1ccnc2c1C(O)c1ccccc1-2.
What is the InChIKey of 4-methyl-5H-indeno[1,2-b]pyridin-5-ol?
The InChIKey is QPDHHOPKWKFAIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-8-6-7-14-12-9-4-2-3-5-10(9)13(15)11(8)12/h2-7,13,15H,1H3.
What are the key properties of 4-methyl-5H-indeno[1,2-b]pyridin-5-ol?
4-methyl-5H-indeno[1,2-b]pyridin-5-ol has a molecular weight of 197.24 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5H-indeno[1,2-b]pyridin-5-ol is sourced from PubChem (CID 11159919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).