About 3-bromo-2,5-dimethoxy-2,5-dihydrofuran
3-bromo-2,5-dimethoxy-2,5-dihydrofuran (PubChem CID 11160099) has the molecular formula C6H9BrO3
and a molecular weight of 209.04 g/mol. Its IUPAC name is 3-bromo-2,5-dimethoxy-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 3-bromo-2,5-dimethoxy-2,5-dihydrofuran |
| PubChem CID | 11160099 |
| Molecular Formula | C6H9BrO3 |
| Molecular Weight | 209.04 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | 3-bromo-2,5-dimethoxy-2,5-dihydrofuran |
| SMILES | COC1C=C(Br)C(OC)O1 |
| InChI | InChI=1S/C6H9BrO3/c1-8-5-3-4(7)6(9-2)10-5/h3,5-6H,1-2H3 |
| InChIKey | RUBCKABMZZZEAK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.04 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2,5-dimethoxy-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,5-dimethoxy-2,5-dihydrofuran?
The IUPAC name of 3-bromo-2,5-dimethoxy-2,5-dihydrofuran (CID 11160099) is 3-bromo-2,5-dimethoxy-2,5-dihydrofuran.
What is the SMILES notation for 3-bromo-2,5-dimethoxy-2,5-dihydrofuran?
The canonical SMILES for 3-bromo-2,5-dimethoxy-2,5-dihydrofuran is COC1C=C(Br)C(OC)O1.
What is the InChIKey of 3-bromo-2,5-dimethoxy-2,5-dihydrofuran?
The InChIKey is RUBCKABMZZZEAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO3/c1-8-5-3-4(7)6(9-2)10-5/h3,5-6H,1-2H3.
What are the key properties of 3-bromo-2,5-dimethoxy-2,5-dihydrofuran?
3-bromo-2,5-dimethoxy-2,5-dihydrofuran has a molecular weight of 209.04 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,5-dimethoxy-2,5-dihydrofuran is sourced from PubChem (CID 11160099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).