About 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea
1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 111601491) has the molecular formula C8H13F3N2O2S
and a molecular weight of 258.26 g/mol. Its IUPAC name is 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea |
| PubChem CID | 111601491 |
| Molecular Formula | C8H13F3N2O2S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NCC1(O)CCSC1 |
| InChI | InChI=1S/C8H13F3N2O2S/c9-8(10,11)4-13-6(14)12-3-7(15)1-2-16-5-7/h15H,1-5H2,(H2,12,13,14) |
| InChIKey | JJMSGKZFRVTDOO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea?
The IUPAC name of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea (CID 111601491) is 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea.
What is the SMILES notation for 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea?
The canonical SMILES for 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea is O=C(NCC(F)(F)F)NCC1(O)CCSC1.
What is the InChIKey of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea?
The InChIKey is JJMSGKZFRVTDOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O2S/c9-8(10,11)4-13-6(14)12-3-7(15)1-2-16-5-7/h15H,1-5H2,(H2,12,13,14).
What are the key properties of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea?
1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea has a molecular weight of 258.26 g/mol, XLogP of 0.72, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-hydroxythiolan-3-yl)methyl]-3-(2,2,2-trifluoroethyl)urea is sourced from PubChem (CID 111601491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).