C10H17N2O3+ — CID 11160168
(Z)-2-[(4S,6R)-2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl]-2-hydroxyethenediazonium (PubChem CID 11160168) has the molecular formula C10H17N2O3+ and a molecular weight of 213.26 g/mol. Its IUPAC name is (Z)-2-[(4S,6R)-2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl]-2-hydroxyethenediazonium.
| Compound Name | (Z)-2-[(4S,6R)-2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl]-2-hydroxyethenediazonium |
|---|---|
| PubChem CID | 11160168 |
| Molecular Formula | C10H17N2O3+ |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (Z)-2-[(4S,6R)-2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl]-2-hydroxyethenediazonium |
| SMILES | CCC1(/C(O)=C/[N+]#N)O[C@H](C)C[C@H](C)O1 |
| InChI | InChI=1S/C10H16N2O3/c1-4-10(9(13)6-12-11)14-7(2)5-8(3)15-10/h6-8H,4-5H2,1-3H3/p+1/b9-6-/t7-,8+,10? |
| InChIKey | HUQQGXRPVVKHLI-YMEPVGJBSA-O |
| XLogP | 2.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|