C20H24N4O — CID 111602489
1-ethyl-2-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111602489) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111602489 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-ethyl-2-[(3-methyl-1-benzofuran-2-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1oc2ccccc2c1C)NCCc1ccccn1 |
| InChI | InChI=1S/C20H24N4O/c1-3-21-20(23-13-11-16-8-6-7-12-22-16)24-14-19-15(2)17-9-4-5-10-18(17)25-19/h4-10,12H,3,11,13-14H2,1-2H3,(H2,21,23,24) |
| InChIKey | HRMOCJXLIPURJF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|