About N'-(2,6-dichlorophenyl)propane-1,3-diamine
N'-(2,6-dichlorophenyl)propane-1,3-diamine (PubChem CID 11160304) has the molecular formula C9H12Cl2N2
and a molecular weight of 219.12 g/mol. Its IUPAC name is N'-(2,6-dichlorophenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2,6-dichlorophenyl)propane-1,3-diamine |
| PubChem CID | 11160304 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | N'-(2,6-dichlorophenyl)propane-1,3-diamine |
| SMILES | NCCCNc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H12Cl2N2/c10-7-3-1-4-8(11)9(7)13-6-2-5-12/h1,3-4,13H,2,5-6,12H2 |
| InChIKey | WMJQGIAIUBXESJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,6-dichlorophenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,6-dichlorophenyl)propane-1,3-diamine?
The IUPAC name of N'-(2,6-dichlorophenyl)propane-1,3-diamine (CID 11160304) is N'-(2,6-dichlorophenyl)propane-1,3-diamine.
What is the SMILES notation for N'-(2,6-dichlorophenyl)propane-1,3-diamine?
The canonical SMILES for N'-(2,6-dichlorophenyl)propane-1,3-diamine is NCCCNc1c(Cl)cccc1Cl.
What is the InChIKey of N'-(2,6-dichlorophenyl)propane-1,3-diamine?
The InChIKey is WMJQGIAIUBXESJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2/c10-7-3-1-4-8(11)9(7)13-6-2-5-12/h1,3-4,13H,2,5-6,12H2.
What are the key properties of N'-(2,6-dichlorophenyl)propane-1,3-diamine?
N'-(2,6-dichlorophenyl)propane-1,3-diamine has a molecular weight of 219.12 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,6-dichlorophenyl)propane-1,3-diamine is sourced from PubChem (CID 11160304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).