About pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone
pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone (PubChem CID 11160307) has the molecular formula C11H9NO4
and a molecular weight of 219.20 g/mol. Its IUPAC name is pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone.
Molecular Properties
| Compound Name | pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone |
| PubChem CID | 11160307 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)cc(O)cc1O)n1cccc1 |
| InChI | InChI=1S/C11H9NO4/c13-7-5-8(14)10(9(15)6-7)11(16)12-3-1-2-4-12/h1-6,13-15H |
| InChIKey | RYGSNHBTZDYVSS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone?
The IUPAC name of pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone (CID 11160307) is pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone.
What is the SMILES notation for pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone?
The canonical SMILES for pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone is O=C(c1c(O)cc(O)cc1O)n1cccc1.
What is the InChIKey of pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone?
The InChIKey is RYGSNHBTZDYVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c13-7-5-8(14)10(9(15)6-7)11(16)12-3-1-2-4-12/h1-6,13-15H.
What are the key properties of pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone?
pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone has a molecular weight of 219.20 g/mol, XLogP of 1.29, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrol-1-yl-(2,4,6-trihydroxyphenyl)methanone is sourced from PubChem (CID 11160307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).