C21H31IN4O2 — CID 111603382
2-[[(cyclohexylamino)-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111603382) has the molecular formula C21H31IN4O2 and a molecular weight of 498.41 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(cyclohexylamino)-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111603382 |
| Molecular Formula | C21H31IN4O2 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2-[[(cyclohexylamino)-[(3-methyl-1-benzofuran-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | Cc1c(CN/C(=N\CC(=O)N(C)C)NC2CCCCC2)oc2ccccc12.I |
| InChI | InChI=1S/C21H30N4O2.HI/c1-15-17-11-7-8-12-18(17)27-19(15)13-22-21(23-14-20(26)25(2)3)24-16-9-5-4-6-10-16;/h7-8,11-12,16H,4-6,9-10,13-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | PVPZEOVCYXTLRW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|