C16H24N4O3S — CID 111603393
1-[3-(methanesulfonamido)propyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine (PubChem CID 111603393) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)propyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine.
| Compound Name | 1-[3-(methanesulfonamido)propyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111603393 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[3-(methanesulfonamido)propyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C16H24N4O3S/c1-12-13-7-4-5-8-14(13)23-15(12)11-19-16(17-2)18-9-6-10-20-24(3,21)22/h4-5,7-8,20H,6,9-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | RCBYFOOZQUEHGG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|