C14H20IN3O — CID 111603498
1,1,2-trimethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111603498) has the molecular formula C14H20IN3O and a molecular weight of 373.24 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,1,2-trimethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111603498 |
| Molecular Formula | C14H20IN3O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1,1,2-trimethyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1oc2ccccc2c1C)N(C)C.I |
| InChI | InChI=1S/C14H19N3O.HI/c1-10-11-7-5-6-8-12(11)18-13(10)9-16-14(15-2)17(3)4;/h5-8H,9H2,1-4H3,(H,15,16);1H |
| InChIKey | KXJPNPCVENUEIS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|