C16H24BrFN4O — CID 111604248
3-[[N-[3-(4-bromo-2-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide (PubChem CID 111604248) has the molecular formula C16H24BrFN4O and a molecular weight of 387.30 g/mol. Its IUPAC name is 3-[[N-[3-(4-bromo-2-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[N-[3-(4-bromo-2-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 111604248 |
| Molecular Formula | C16H24BrFN4O |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-[[N-[3-(4-bromo-2-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
| SMILES | C/N=C(/NCCCc1ccc(Br)cc1F)NCCC(=O)N(C)C |
| InChI | InChI=1S/C16H24BrFN4O/c1-19-16(21-10-8-15(23)22(2)3)20-9-4-5-12-6-7-13(17)11-14(12)18/h6-7,11H,4-5,8-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | QUOXABYAMLNBKP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|