C14H18O3 — CID 11160655
(1S)-1,2,3,4,5,6,7,8-octahydroanthracene-1,9,10-triol (PubChem CID 11160655) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1S)-1,2,3,4,5,6,7,8-octahydroanthracene-1,9,10-triol.
| Compound Name | (1S)-1,2,3,4,5,6,7,8-octahydroanthracene-1,9,10-triol |
|---|---|
| PubChem CID | 11160655 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1S)-1,2,3,4,5,6,7,8-octahydroanthracene-1,9,10-triol |
| SMILES | Oc1c2c(c(O)c3c1CCC[C@@H]3O)CCCC2 |
| InChI | InChI=1S/C14H18O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h11,15-17H,1-7H2/t11-/m0/s1 |
| InChIKey | ZTYAQCAYUXPHQX-NSHDSACASA-N |
| XLogP | 2.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|