C19H32IN3O — CID 111606558
1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide (PubChem CID 111606558) has the molecular formula C19H32IN3O and a molecular weight of 445.39 g/mol. Its IUPAC name is 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111606558 |
| Molecular Formula | C19H32IN3O |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-ethyl-2-(2-methoxy-2-methylpropyl)-3-[(1-phenylcyclobutyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)OC)NCC1(c2ccccc2)CCC1.I |
| InChI | InChI=1S/C19H31N3O.HI/c1-5-20-17(21-14-18(2,3)23-4)22-15-19(12-9-13-19)16-10-7-6-8-11-16;/h6-8,10-11H,5,9,12-15H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | FDVALXMIPWENTB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|