C17H16O — CID 11160715
(6bS,10aS)-6b,7,9,10,10a,11-hexahydrobenzo[a]fluoren-8-one (PubChem CID 11160715) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is (6bS,10aS)-6b,7,9,10,10a,11-hexahydrobenzo[a]fluoren-8-one.
| Compound Name | (6bS,10aS)-6b,7,9,10,10a,11-hexahydrobenzo[a]fluoren-8-one |
|---|---|
| PubChem CID | 11160715 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (6bS,10aS)-6b,7,9,10,10a,11-hexahydrobenzo[a]fluoren-8-one |
| SMILES | O=C1CC[C@H]2Cc3c(ccc4ccccc34)[C@H]2C1 |
| InChI | InChI=1S/C17H16O/c18-13-7-5-12-9-17-14-4-2-1-3-11(14)6-8-15(17)16(12)10-13/h1-4,6,8,12,16H,5,7,9-10H2/t12-,16-/m0/s1 |
| InChIKey | UWPYKJSXGOIMFE-LRDDRELGSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |