C15H33IN4O3 — CID 111607598
2-[[(3-ethoxypropylamino)-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111607598) has the molecular formula C15H33IN4O3 and a molecular weight of 444.36 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111607598 |
| Molecular Formula | C15H33IN4O3 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)NCC(C)(C)OC.I |
| InChI | InChI=1S/C15H32N4O3.HI/c1-7-22-10-8-9-16-14(17-11-13(20)19(4)5)18-12-15(2,3)21-6;/h7-12H2,1-6H3,(H2,16,17,18);1H |
| InChIKey | DGPMVTNKHYYWIZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|