C7HF4NS2 — CID 11160776
4,5,6,7-tetrafluoro-3H-1,3-benzothiazole-2-thione (PubChem CID 11160776) has the molecular formula C7HF4NS2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-3H-1,3-benzothiazole-2-thione.
| Compound Name | 4,5,6,7-tetrafluoro-3H-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 11160776 |
| Molecular Formula | C7HF4NS2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 238.95 |
| IUPAC Name | 4,5,6,7-tetrafluoro-3H-1,3-benzothiazole-2-thione |
| SMILES | Fc1c(F)c(F)c2sc(=S)[nH]c2c1F |
| InChI | InChI=1S/C7HF4NS2/c8-1-2(9)4(11)6-5(3(1)10)12-7(13)14-6/h(H,12,13) |
| InChIKey | AVWSRQLOHNLLTF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|