C15H19NO2 — CID 11160920
methyl (1S,2S,6R,7R,9S)-11-azapentacyclo[6.4.2.01,9.02,6.07,9]tetradec-13-ene-11-carboxylate (PubChem CID 11160920) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl (1S,2S,6R,7R,9S)-11-azapentacyclo[6.4.2.01,9.02,6.07,9]tetradec-13-ene-11-carboxylate.
| Compound Name | methyl (1S,2S,6R,7R,9S)-11-azapentacyclo[6.4.2.01,9.02,6.07,9]tetradec-13-ene-11-carboxylate |
|---|---|
| PubChem CID | 11160920 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | methyl (1S,2S,6R,7R,9S)-11-azapentacyclo[6.4.2.01,9.02,6.07,9]tetradec-13-ene-11-carboxylate |
| SMILES | COC(=O)N1C[C@@]23C=CC4[C@@H]([C@@H]5CCC[C@@H]52)[C@@]43C1 |
| InChI | InChI=1S/C15H19NO2/c1-18-13(17)16-7-14-6-5-11-12(15(11,14)8-16)9-3-2-4-10(9)14/h5-6,9-12H,2-4,7-8H2,1H3/t9-,10+,11?,12-,14+,15-/m1/s1 |
| InChIKey | QXXWGPLDBNORKR-VDQJCRHBSA-N |
| XLogP | 2.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|