C16H29IN4O2S2 — CID 111609225
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111609225) has the molecular formula C16H29IN4O2S2 and a molecular weight of 500.47 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111609225 |
| Molecular Formula | C16H29IN4O2S2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1ccc(C)cc1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C16H28N4O2S2.HI/c1-13-6-8-14(9-7-13)24(21,22)20-11-10-18-15(17-4)19-12-16(2,3)23-5;/h6-9,20H,10-12H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | XZPOHENCFAYIIM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|