C18H31IN4OS — CID 111610703
N-benzyl-N-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111610703) has the molecular formula C18H31IN4OS and a molecular weight of 478.44 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-benzyl-N-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111610703 |
| Molecular Formula | C18H31IN4OS |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-benzyl-N-methyl-3-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)N(C)Cc1ccccc1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C18H30N4OS.HI/c1-18(2,24-5)14-21-17(19-3)20-12-11-16(23)22(4)13-15-9-7-6-8-10-15;/h6-10H,11-14H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | SJHKQDFJVOIVMJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|