C16H27BrIN3OS — CID 111612881
1-[4-(2-bromophenyl)sulfanylbutyl]-2-(3-ethoxypropyl)guanidine;hydroiodide (PubChem CID 111612881) has the molecular formula C16H27BrIN3OS and a molecular weight of 516.29 g/mol. Its IUPAC name is 1-[4-(2-bromophenyl)sulfanylbutyl]-2-(3-ethoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[4-(2-bromophenyl)sulfanylbutyl]-2-(3-ethoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111612881 |
| Molecular Formula | C16H27BrIN3OS |
| Molecular Weight | 516.29 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | 1-[4-(2-bromophenyl)sulfanylbutyl]-2-(3-ethoxypropyl)guanidine;hydroiodide |
| SMILES | CCOCCC/N=C(\N)NCCCCSc1ccccc1Br.I |
| InChI | InChI=1S/C16H26BrN3OS.HI/c1-2-21-12-7-11-20-16(18)19-10-5-6-13-22-15-9-4-3-8-14(15)17;/h3-4,8-9H,2,5-7,10-13H2,1H3,(H3,18,19,20);1H |
| InChIKey | CPKLYZQMAZIGSB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|