C19H27BrN4OS — CID 111612906
1-[4-(2-bromophenyl)sulfanylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine (PubChem CID 111612906) has the molecular formula C19H27BrN4OS and a molecular weight of 439.42 g/mol. Its IUPAC name is 1-[4-(2-bromophenyl)sulfanylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[4-(2-bromophenyl)sulfanylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111612906 |
| Molecular Formula | C19H27BrN4OS |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-[4-(2-bromophenyl)sulfanylbutyl]-2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCCCSc1ccccc1Br |
| InChI | InChI=1S/C19H27BrN4OS/c1-4-21-19(23-13-18-24-14(2)15(3)25-18)22-11-7-8-12-26-17-10-6-5-9-16(17)20/h5-6,9-10H,4,7-8,11-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | DBBCXVNNCOTFDH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|