C21H26IN5O2S — CID 111613577
1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111613577) has the molecular formula C21H26IN5O2S and a molecular weight of 539.44 g/mol. Its IUPAC name is 1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111613577 |
| Molecular Formula | C21H26IN5O2S |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 1-[(2-imidazol-1-ylphenyl)methyl]-2-methyl-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(S(C)(=O)=O)cc1)NCc1ccccc1-n1ccnc1.I |
| InChI | InChI=1S/C21H25N5O2S.HI/c1-22-21(24-12-11-17-7-9-19(10-8-17)29(2,27)28)25-15-18-5-3-4-6-20(18)26-14-13-23-16-26;/h3-10,13-14,16H,11-12,15H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | ZEJIAPUDDHRIDE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|