C18H28F3IN4O2S — CID 111614257
1-ethyl-2-[2-(4-methylsulfonylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111614257) has the molecular formula C18H28F3IN4O2S and a molecular weight of 548.41 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methylsulfonylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-methylsulfonylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111614257 |
| Molecular Formula | C18H28F3IN4O2S |
| Molecular Weight | 548.41 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 1-ethyl-2-[2-(4-methylsulfonylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(S(C)(=O)=O)cc1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H27F3N4O2S.HI/c1-3-22-17(24-15-9-11-25(12-15)13-18(19,20)21)23-10-8-14-4-6-16(7-5-14)28(2,26)27;/h4-7,15H,3,8-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | CETXIAWYOPYJRV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|