C17H29F3IN5OS — CID 111615925
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615925) has the molecular formula C17H29F3IN5OS and a molecular weight of 535.42 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615925 |
| Molecular Formula | C17H29F3IN5OS |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCCN1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C17H28F3N5OS.HI/c1-4-21-16(23-8-15-24-14(11-27-15)17(18,19)20)22-6-5-7-25-9-12(2)26-13(3)10-25;/h11-13H,4-10H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | RXMRNYWHQKWVJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|