About benzyl 3-aminopropanoate
benzyl 3-aminopropanoate (PubChem CID 1116164) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is benzyl 3-aminopropanoate.
Molecular Properties
| Compound Name | benzyl 3-aminopropanoate |
| PubChem CID | 1116164 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | benzyl 3-aminopropanoate |
| SMILES | NCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5H,6-8,11H2 |
| InChIKey | CANCPUBPPUIWPX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-aminopropanoate?
The IUPAC name of benzyl 3-aminopropanoate (CID 1116164) is benzyl 3-aminopropanoate.
What is the SMILES notation for benzyl 3-aminopropanoate?
The canonical SMILES for benzyl 3-aminopropanoate is NCCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-aminopropanoate?
The InChIKey is CANCPUBPPUIWPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5H,6-8,11H2.
What are the key properties of benzyl 3-aminopropanoate?
benzyl 3-aminopropanoate has a molecular weight of 179.22 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-aminopropanoate is sourced from PubChem (CID 1116164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).