C12H14F3N5S2 — CID 111616509
2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111616509) has the molecular formula C12H14F3N5S2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111616509 |
| Molecular Formula | C12H14F3N5S2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1cnc(C)s1)NCc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C12H14F3N5S2/c1-7-17-3-8(22-7)4-18-11(16-2)19-5-10-20-9(6-21-10)12(13,14)15/h3,6H,4-5H2,1-2H3,(H2,16,18,19) |
| InChIKey | AEWNDCBOXJGVSE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|