C15H19F3IN9S — CID 111616598
2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616598) has the molecular formula C15H19F3IN9S and a molecular weight of 541.35 g/mol. Its IUPAC name is 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616598 |
| Molecular Formula | C15H19F3IN9S |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncnc2c1cnn2C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H18F3N9S.HI/c1-19-14(22-6-11-26-10(7-28-11)15(16,17)18)21-4-3-20-12-9-5-25-27(2)13(9)24-8-23-12;/h5,7-8H,3-4,6H2,1-2H3,(H2,19,21,22)(H,20,23,24);1H |
| InChIKey | PZJGAQNBRBGRTQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|