C15H23F3IN7S — CID 111616979
1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616979) has the molecular formula C15H23F3IN7S and a molecular weight of 517.36 g/mol. Its IUPAC name is 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616979 |
| Molecular Formula | C15H23F3IN7S |
| Molecular Weight | 517.36 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C15H22F3N7S.HI/c1-4-5-6-19-14(20-7-12-24-23-10(2)25(12)3)21-8-13-22-11(9-26-13)15(16,17)18;/h9H,4-8H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | YMJCLRGAFKLBHV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|