About 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea
1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 111619075) has the molecular formula C9H15F3N2O2S
and a molecular weight of 272.29 g/mol. Its IUPAC name is 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea.
Molecular Properties
| Compound Name | 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea |
| PubChem CID | 111619075 |
| Molecular Formula | C9H15F3N2O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCCC(F)(F)F)NCC1(O)CCSC1 |
| InChI | InChI=1S/C9H15F3N2O2S/c10-9(11,12)1-3-13-7(15)14-5-8(16)2-4-17-6-8/h16H,1-6H2,(H2,13,14,15) |
| InChIKey | NSZLZLOQPQRILH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea?
The IUPAC name of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea (CID 111619075) is 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea.
What is the SMILES notation for 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea?
The canonical SMILES for 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea is O=C(NCCC(F)(F)F)NCC1(O)CCSC1.
What is the InChIKey of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea?
The InChIKey is NSZLZLOQPQRILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O2S/c10-9(11,12)1-3-13-7(15)14-5-8(16)2-4-17-6-8/h16H,1-6H2,(H2,13,14,15).
What are the key properties of 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea?
1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea has a molecular weight of 272.29 g/mol, XLogP of 1.11, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-hydroxythiolan-3-yl)methyl]-3-(3,3,3-trifluoropropyl)urea is sourced from PubChem (CID 111619075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).