C16H32O2Si — CID 11161923
tert-butyl-[[(2S,5S)-5-tert-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane (PubChem CID 11161923) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is tert-butyl-[[(2S,5S)-5-tert-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,5S)-5-tert-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11161923 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl-[[(2S,5S)-5-tert-butyl-3-methyl-2,5-dihydrofuran-2-yl]methoxy]-dimethylsilane |
| SMILES | CC1=C[C@@H](C(C)(C)C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2Si/c1-12-10-14(15(2,3)4)18-13(12)11-17-19(8,9)16(5,6)7/h10,13-14H,11H2,1-9H3/t13-,14+/m1/s1 |
| InChIKey | QURIGDDUFSQHSL-KGLIPLIRSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|