C21H36N4O — CID 111619338
1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111619338) has the molecular formula C21H36N4O and a molecular weight of 360.55 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111619338 |
| Molecular Formula | C21H36N4O |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | 1-(2,2-dimethyl-3-phenylpropyl)-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | C/N=C(\NCC(C)(C)Cc1ccccc1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C21H36N4O/c1-20(2,15-18-9-7-6-8-10-18)16-23-19(22-5)24-17-21(3,4)25-11-13-26-14-12-25/h6-10H,11-17H2,1-5H3,(H2,22,23,24) |
| InChIKey | QZJUWKQXEOGCAM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|