About cyclohexane-1,4-diol
cyclohexane-1,4-diol (PubChem CID 11162) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is cyclohexane-1,4-diol.
Molecular Properties
| Compound Name | cyclohexane-1,4-diol |
| PubChem CID | 11162 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | cyclohexane-1,4-diol |
| SMILES | OC1CCC(O)CC1 |
| InChI | InChI=1S/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2 |
| InChIKey | VKONPUDBRVKQLM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,4-diol?
The IUPAC name of cyclohexane-1,4-diol (CID 11162) is cyclohexane-1,4-diol.
What is the SMILES notation for cyclohexane-1,4-diol?
The canonical SMILES for cyclohexane-1,4-diol is OC1CCC(O)CC1.
What is the InChIKey of cyclohexane-1,4-diol?
The InChIKey is VKONPUDBRVKQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2.
What are the key properties of cyclohexane-1,4-diol?
cyclohexane-1,4-diol has a molecular weight of 116.16 g/mol, XLogP of 0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,4-diol is sourced from PubChem (CID 11162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).