C23H37N3O3 — CID 111620384
methyl 6-[[N-ethyl-N'-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]hexanoate (PubChem CID 111620384) has the molecular formula C23H37N3O3 and a molecular weight of 403.57 g/mol. Its IUPAC name is methyl 6-[[N-ethyl-N'-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]hexanoate.
| Compound Name | methyl 6-[[N-ethyl-N'-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]hexanoate |
|---|---|
| PubChem CID | 111620384 |
| Molecular Formula | C23H37N3O3 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | methyl 6-[[N-ethyl-N'-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]hexanoate |
| SMILES | CCN/C(=N\CC1CCCOC1c1ccc(C)cc1)NCCCCCC(=O)OC |
| InChI | InChI=1S/C23H37N3O3/c1-4-24-23(25-15-7-5-6-10-21(27)28-3)26-17-20-9-8-16-29-22(20)19-13-11-18(2)12-14-19/h11-14,20,22H,4-10,15-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | UXTNZTIRSOWIJQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|