C25H36IN3O2 — CID 111620945
1-ethyl-2-(2-methyl-3-phenylmethoxypropyl)-3-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111620945) has the molecular formula C25H36IN3O2 and a molecular weight of 537.49 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-3-phenylmethoxypropyl)-3-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-3-phenylmethoxypropyl)-3-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111620945 |
| Molecular Formula | C25H36IN3O2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 1-ethyl-2-(2-methyl-3-phenylmethoxypropyl)-3-[(2-phenyloxolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)COCc1ccccc1)NCC1CCOC1c1ccccc1.I |
| InChI | InChI=1S/C25H35N3O2.HI/c1-3-26-25(27-16-20(2)18-29-19-21-10-6-4-7-11-21)28-17-23-14-15-30-24(23)22-12-8-5-9-13-22;/h4-13,20,23-24H,3,14-19H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | GFCYRHFLNSICRP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|