C17H24O4 — CID 11162151
(4'aR,8'S,8'aR)-8'-methoxy-2',5,5-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one (PubChem CID 11162151) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4'aR,8'S,8'aR)-8'-methoxy-2',5,5-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'aR,8'S,8'aR)-8'-methoxy-2',5,5-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 11162151 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (4'aR,8'S,8'aR)-8'-methoxy-2',5,5-trimethylspiro[1,3-dioxane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
| SMILES | CO[C@H]1C=CC[C@@H]2[C@H]1C(=O)C(C)=CC21OCC(C)(C)CO1 |
| InChI | InChI=1S/C17H24O4/c1-11-8-17(20-9-16(2,3)10-21-17)12-6-5-7-13(19-4)14(12)15(11)18/h5,7-8,12-14H,6,9-10H2,1-4H3/t12-,13+,14-/m1/s1 |
| InChIKey | FTZRGDRBLGIGII-HZSPNIEDSA-N |
| XLogP | 2.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|