C20H36N4 — CID 111621918
1-[4-(diethylamino)butyl]-2-methyl-3-[2-(4-methylphenyl)propyl]guanidine (PubChem CID 111621918) has the molecular formula C20H36N4 and a molecular weight of 332.54 g/mol. Its IUPAC name is 1-[4-(diethylamino)butyl]-2-methyl-3-[2-(4-methylphenyl)propyl]guanidine.
| Compound Name | 1-[4-(diethylamino)butyl]-2-methyl-3-[2-(4-methylphenyl)propyl]guanidine |
|---|---|
| PubChem CID | 111621918 |
| Molecular Formula | C20H36N4 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | 1-[4-(diethylamino)butyl]-2-methyl-3-[2-(4-methylphenyl)propyl]guanidine |
| SMILES | CCN(CC)CCCCN/C(=N\C)NCC(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H36N4/c1-6-24(7-2)15-9-8-14-22-20(21-5)23-16-18(4)19-12-10-17(3)11-13-19/h10-13,18H,6-9,14-16H2,1-5H3,(H2,21,22,23) |
| InChIKey | YGURBIHPAWGDSV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|