C17H26O4 — CID 11162208
(1R,3S,8R,11S,13R,18S,20R)-20-methyl-2,7,12,17-tetraoxatetracyclo[9.9.0.03,8.013,18]icos-9-ene (PubChem CID 11162208) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1R,3S,8R,11S,13R,18S,20R)-20-methyl-2,7,12,17-tetraoxatetracyclo[9.9.0.03,8.013,18]icos-9-ene.
| Compound Name | (1R,3S,8R,11S,13R,18S,20R)-20-methyl-2,7,12,17-tetraoxatetracyclo[9.9.0.03,8.013,18]icos-9-ene |
|---|---|
| PubChem CID | 11162208 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (1R,3S,8R,11S,13R,18S,20R)-20-methyl-2,7,12,17-tetraoxatetracyclo[9.9.0.03,8.013,18]icos-9-ene |
| SMILES | C[C@@H]1C[C@@H]2OCCC[C@H]2O[C@H]2C=C[C@H]3OCCC[C@@H]3O[C@H]12 |
| InChI | InChI=1S/C17H26O4/c1-11-10-16-14(5-3-9-19-16)20-15-7-6-12-13(21-17(11)15)4-2-8-18-12/h6-7,11-17H,2-5,8-10H2,1H3/t11-,12-,13+,14-,15+,16+,17-/m1/s1 |
| InChIKey | XNROXHQSBLYBKB-PCEZLPAMSA-N |
| XLogP | 2.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|